Difference between revisions of "PWY-5366"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** palmitoleate biosynthesis II (plants and bacteria) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** palmitoleic acid biosynthesis |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-9550]] |
| − | == Reaction(s) | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8389 RXN-8389] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=palmitoleate biosynthesis II (plants and bacteria)}} | |
| − | + | {{#set: common name=palmitoleic acid biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:05, 21 March 2018
Pathway PWY-5366
- taxonomic range:
- common name:
- palmitoleate biosynthesis II (plants and bacteria)
- Synonym(s):
- palmitoleic acid biosynthesis
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-9550
- 0 associated gene:
- 1 reconstruction source(s) associated:
