Difference between revisions of "PWY-5366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
+
 
* common name:
 
* common name:
** 9(S)-HPOTE
+
** palmitoleate biosynthesis II (plants and bacteria)
* molecular weight:
+
** 309.425   
+
 
* Synonym(s):
 
* Synonym(s):
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
+
** palmitoleic acid biosynthesis
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-8497]]
+
* [[RXN-9550]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8389 RXN-8389]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=palmitoleate biosynthesis II (plants and bacteria)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962]
+
{{#set: common name=palmitoleic acid biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321]
+
{{#set: total reaction=2}}
{{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}}
+
{{#set: completion rate=50.0}}
{{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}}
+
{{#set: common name=9(S)-HPOTE}}
+
{{#set: molecular weight=309.425    }}
+
{{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}}
+
{{#set: produced by=RXN-8497}}
+

Latest revision as of 19:05, 21 March 2018

Pathway PWY-5366

  • taxonomic range:
  • common name:
    • palmitoleate biosynthesis II (plants and bacteria)
  • Synonym(s):
    • palmitoleic acid biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links