Difference between revisions of "RIBOSYN2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * inchi key: ** InChIKey=FSQQTNAZHBEJ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-330...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C(=CC(=O)[O-])C(N)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
+
 
* common name:
 
* common name:
−
** maleamate
+
** flavin biosynthesis I (bacteria and plants)
−
* molecular weight:
+
−
** 114.08   
+
 
* Synonym(s):
 
* Synonym(s):
−
** maleic acid monoamide
+
** riboflavin, FMN and FAD biosynthesis
−
** maleamic acid
+
** vitamin B2 biosynthesis
−
** (Z)-4-amino-4-oxo-but-2-enoate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-646]]
+
'''8''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[DIOHBUTANONEPSYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-27_004040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FADSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_006670]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-27_004040]]
 +
*** [[Ec-02_005710]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[LUMAZINESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002140]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RIBOFLAVIN-SYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-00_004570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-04_001490]]
 +
*** [[Ec-04_004280]]
 +
*** [[Ec-10_002950]]
 +
*** [[Ec-14_005260]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RIBOFLAVINSYNDEAM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-07_005770]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RIBOFLAVINSYNREDUC-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-05_004210]]
 +
*** [[Ec-23_000290]]
 +
*** [[Ec-07_005770]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RIBOPHOSPHAT-RXN RIBOPHOSPHAT-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 557-24-4
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391]
+
* ARACYC:
−
* CHEMSPIDER:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY]
−
** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932]
+
{{#set: taxonomic range=TAX-33090}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146]
+
{{#set: common name=flavin biosynthesis I (bacteria and plants)}}
−
* LIGAND-CPD:
+
{{#set: common name=riboflavin, FMN and FAD biosynthesis|vitamin B2 biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596]
+
{{#set: reaction found=8}}
−
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}}
+
{{#set: total reaction=9}}
−
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}}
+
{{#set: completion rate=89.0}}
−
{{#set: common name=maleamate}}
+
−
{{#set: molecular weight=114.08    }}
+
−
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}}
+
−
{{#set: consumed by=RXN-646}}
+

Latest revision as of 19:05, 21 March 2018

Pathway RIBOSYN2-PWY

  • taxonomic range:
  • common name:
    • flavin biosynthesis I (bacteria and plants)
  • Synonym(s):
    • riboflavin, FMN and FAD biosynthesis
    • vitamin B2 biosynthesis

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RIBOSYN2-PWY&oldid=24470"