Difference between revisions of "RXN-12056"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == * smiles: ** CCC=CCC=CCC=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12056 RXN-12056] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12056 RXN-12056] ==
* smiles:
+
* direction:
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
+
** [http://enzyme.expasy.org/EC/6.5.1 EC-6.5.1]
* common name:
+
** icosapentaenoate
+
* molecular weight:
+
** 301.448   
+
 
* Synonym(s):
 
* Synonym(s):
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
 
** timnodonic acid
 
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
 
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
 
** EPA
 
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
 
** eicosapentaenoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12978]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Pre-tRNA-3-prime-half-molecules]][c] '''+''' 2 [[ATP]][c] '''+''' 1 [[Pre-tRNA-5-prime-half-molecules]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-phospho-ligated-tRNA]][c] '''+''' 1 [[ADP]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c]
* [[RXN-16139]]
+
* With common name(s):
* [[RXN-13431]]
+
** 1 a 3' half-tRNA molecule with a hydroxyl on its 5' end[c] '''+''' 2 ATP[c] '''+''' 1 a 5' half-tRNA molecule with a 2',3' cyclic phosphate on its 3' end[c] '''+''' 1 H2O[c] '''=>''' 1 a 2'-phospho-[ligated tRNA][c] '''+''' 1 ADP[c] '''+''' 2 H+[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6689]], tRNA splicing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749]
+
{{#set: ec number=EC-6.5.1}}
* CHEBI:
+
{{#set: in pathway=PWY-6689}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562]
+
{{#set: reconstruction category=annotation}}
* Wikipedia : Eicosapentaenoate
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428]
+
* HMDB : HMDB01999
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}}
+
{{#set: common name=icosapentaenoate}}
+
{{#set: molecular weight=301.448    }}
+
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}}
+
{{#set: consumed by=RXN-12978}}
+
{{#set: produced by=RXN-16139|RXN-13431}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN-12056

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6689, tRNA splicing: PWY-6689
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links