Difference between revisions of "Ec-06 009670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Gene == Gene Ec-06_009670 == * left end position: ** 7462961 * transcription direction: ** POSITIVE * right end position: ** 7467137 * centisome position: ** 85.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+
== Gene Ec-06_009670 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 7462961
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2E,11Z)-octadecenoyl-CoA
+
** 7467137
−
* molecular weight:
+
* centisome position:
−
** 1025.937    
+
** 85.21542    
 
* Synonym(s):
 
* Synonym(s):
−
** 18:2-Δ2,Δ11-CoA
+
** Esi_0086_0068
−
** 2-trans,11-cis-octadecenoyl-CoA
+
** Esi0086_0068
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17785]]
+
* Reaction: [[SQUALENE-MONOOXYGENASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17784]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5670]]
 +
* [[PWY-6098]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=7462961}}
−
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
+
{{#set: right end position=7467137}}
−
{{#set: molecular weight=1025.937   }}
+
{{#set: centisome position=85.21542   }}
−
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
+
{{#set: common name=Esi_0086_0068|Esi0086_0068}}
−
{{#set: consumed by=RXN-17785}}
+
{{#set: reaction associated=SQUALENE-MONOOXYGENASE-RXN}}
−
{{#set: produced by=RXN-17784}}
+
{{#set: pathway associated=PWY-5670|PWY-6098}}

Latest revision as of 19:05, 21 March 2018

Gene Ec-06_009670

  • left end position:
    • 7462961
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7467137
  • centisome position:
    • 85.21542
  • Synonym(s):
    • Esi_0086_0068
    • Esi0086_0068

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_009670&oldid=24484"