Difference between revisions of "RXN-12490"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] == * smiles: ** C1(NC=NC=1C(C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12490 RXN-12490] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12490 RXN-12490] ==
−
* smiles:
+
* direction:
−
** C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L
+
 
* common name:
 
* common name:
−
** D-erythro-imidazole-glycerol-phosphate
+
** 6-phosphogluconate dehydrogenase, C-terminal-like
−
* molecular weight:
+
** 3-hydroxyacyl-CoA dehydrogenase
−
** 236.121   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
−
** D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate
 
−
** D-erythro-imidazole-glycerol-P
 
−
** erythro-imidazole-glycerol-P
 
−
** erythro-imidazole-glycerol-phosphate
 
−
** imidazole glycerol phosphate
 
−
** IGP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[IMIDPHOSDEHYD-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD0-2244]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD0-2123]][c] '''+''' 1 [[NADH]][c]
−
* [[GLUTAMIDOTRANS-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxydecanoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 3-oxodecanoyl-CoA[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_005290]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-7094]], fatty acid salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7094 PWY-7094]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459954 5459954]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31188 31188]
−
* HMDB : HMDB12208
+
* LIGAND-RXN:
−
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?R04743 R04743]
−
** [http://www.genome.jp/dbget-bin/www_bget?C04666 C04666]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEMSPIDER:
+
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
−
** [http://www.chemspider.com/Chemical-Structure.4573672.html 4573672]
+
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1.35}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58278 58278]
+
{{#set: gene associated=Ec-19_005290|Ec-14_006530}}
−
* BIGG : 44288
+
{{#set: in pathway=PWY-7094}}
−
{{#set: smiles=C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: common name=D-erythro-imidazole-glycerol-phosphate}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=236.121    }}
+
−
{{#set: common name=D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate|D-erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-phosphate|imidazole glycerol phosphate|IGP}}
+
−
{{#set: consumed by=IMIDPHOSDEHYD-RXN}}
+
−
{{#set: produced by=GLUTAMIDOTRANS-RXN}}
+

Latest revision as of 19:05, 21 March 2018

Reaction RXN-12490

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 6-phosphogluconate dehydrogenase, C-terminal-like
    • 3-hydroxyacyl-CoA dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxydecanoyl-CoA[c] => 1 H+[c] + 1 3-oxodecanoyl-CoA[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7094, fatty acid salvage: PWY-7094
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12490&oldid=24487"