Difference between revisions of "Ec-01 002370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Ec-01_002370 == * Synonym(s): ** Esi_0003_0068 ** Esi0003_0068 == Reactions associated == * Reaction: RXN-1404 ** Source: orthology-aragem =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Gene Ec-01_002370 ==
−
* smiles:
+
−
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
−
* common name:
+
−
** 3-oxododecanoyl-CoA
+
−
* molecular weight:
+
−
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxolauroyl-CoA
+
** Esi_0003_0068
 +
** Esi0003_0068
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-1404]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
−
* [[RXN-14274]]
+
== Pathways associated ==
 +
* [[PWY-581]]
 +
* [[PWY-5026]]
 +
* [[PWYQT-4476]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0003_0068|Esi0003_0068}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
{{#set: reaction associated=RXN-1404}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-581|PWY-5026|PWYQT-4476}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
−
* BIGG : 45453
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
−
* HMDB : HMDB03937
+
−
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
−
{{#set: common name=3-oxododecanoyl-CoA}}
+
−
{{#set: molecular weight=959.791    }}
+
−
{{#set: common name=3-oxolauroyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-14274}}
+

Latest revision as of 19:05, 21 March 2018

Gene Ec-01_002370

  • Synonym(s):
    • Esi_0003_0068
    • Esi0003_0068

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_002370&oldid=24490"