Difference between revisions of "Oleoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * smiles: ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oleoyl-ACPs Oleoyl-ACPs] == * common name: ** an oleoyl-[acp] * Synonym(s): ** a (9Z)-octadec-9...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oleoyl-ACPs Oleoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an oleoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a (9Z)-octadec-9-enoyl-[acp] |
| − | ** | + | ** an oleoyl-ACP |
| − | ** | + | ** an oleoyl-[acyl-carrier-protein] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16629]] | ||
| + | * [[RXN-16077]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16628]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=an oleoyl-[acp]}} | |
| − | + | {{#set: common name=a (9Z)-octadec-9-enoyl-[acp]|an oleoyl-ACP|an oleoyl-[acyl-carrier-protein]}} | |
| − | + | {{#set: consumed by=RXN-16629|RXN-16077}} | |
| − | + | {{#set: produced by=RXN-16628}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite Oleoyl-ACPs
- common name:
- an oleoyl-[acp]
- Synonym(s):
- a (9Z)-octadec-9-enoyl-[acp]
- an oleoyl-ACP
- an oleoyl-[acyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an oleoyl-[acp" cannot be used as a page name in this wiki.
- "a (9Z)-octadec-9-enoyl-[acp" cannot be used as a page name in this wiki.
- "an oleoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
