Difference between revisions of "CPD0-2105"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRUVATE-CARBOXYLASE-RXN PYRUVATE-CARBOXYLASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRUVATE-CARBOXYLASE-RXN PYRUVATE-CARBOXYLASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
 
* common name:
 
* common name:
** pyruvate carboxylase
+
** 3-oxododecanoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/6.4.1.1 EC-6.4.1.1]
+
** 959.791   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxolauroyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[PYRUVATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[OXALACETIC_ACID]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-14274]]
** 1 pyruvate[c] '''+''' 1 ATP[c] '''+''' 1 hydrogen carbonate[c] '''=>''' 1 phosphate[c] '''+''' 1 ADP[c] '''+''' 1 oxaloacetate[c] '''+''' 1 H+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-03_001890]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142]
+
** '''10''' reactions found over '''14''' reactions in the full pathway
+
* [[PWY-6146]], Methanobacterium thermoautotrophicum biosynthetic metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6146 PWY-6146]
+
** '''9''' reactions found over '''16''' reactions in the full pathway
+
* [[PWY-5750]], itaconate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5750 PWY-5750]
+
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[P42-PWY]], incomplete reductive TCA cycle: [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY]
+
** '''5''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
+
** '''10''' reactions found over '''12''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* LIGAND-CPD:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20844 20844]
+
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R00344 R00344]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
* UNIPROT:
+
* BIGG : 45453
** [http://www.uniprot.org/uniprot/Q05920 Q05920]
+
* PUBCHEM:
** [http://www.uniprot.org/uniprot/Q9PNQ4 Q9PNQ4]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
** [http://www.uniprot.org/uniprot/P95127 P95127]
+
* HMDB : HMDB03937
** [http://www.uniprot.org/uniprot/Q9PP00 Q9PP00]
+
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.uniprot.org/uniprot/Q9CHQ7 Q9CHQ7]
+
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
** [http://www.uniprot.org/uniprot/Q9KWU4 Q9KWU4]
+
{{#set: common name=3-oxododecanoyl-CoA}}
** [http://www.uniprot.org/uniprot/P11498 P11498]
+
{{#set: molecular weight=959.791    }}
** [http://www.uniprot.org/uniprot/P52873 P52873]
+
{{#set: common name=3-oxolauroyl-CoA}}
** [http://www.uniprot.org/uniprot/P11154 P11154]
+
{{#set: reversible reaction associated=RXN-14274}}
** [http://www.uniprot.org/uniprot/P32327 P32327]
+
** [http://www.uniprot.org/uniprot/O17732 O17732]
+
** [http://www.uniprot.org/uniprot/Q9UUE1 Q9UUE1]
+
** [http://www.uniprot.org/uniprot/Q16921 Q16921]
+
** [http://www.uniprot.org/uniprot/Q9XBJ1 Q9XBJ1]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=pyruvate carboxylase}}
+
{{#set: ec number=EC-6.4.1.1}}
+
{{#set: gene associated=Ec-03_001890}}
+
{{#set: in pathway=PWY-6142|PWY-6146|PWY-5750|P42-PWY|PWY66-399}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:06, 21 March 2018

Metabolite CPD0-2105

  • smiles:
    • CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
  • common name:
    • 3-oxododecanoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • 3-oxolauroyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.