Difference between revisions of "PWY0-1182"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1182 PWY0-1182] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1182 PWY0-1182] ==
* smiles:
+
* taxonomic range:
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-6656]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** gibberellin A12-aldehyde
+
** trehalose degradation II (trehalase)
* molecular weight:
+
** 315.431   
+
 
* Synonym(s):
 
* Synonym(s):
** GA12-aldehyde
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN1F-161]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLUCOKIN-RXN]]
* [[RXN1F-160]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-27_005030]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[TREHALA-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-00_010170]]
 +
*** [[Ec-22_000080]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244417 25244417]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1182 PWY0-1182]
* CHEBI:
+
{{#set: taxonomic range=TAX-6656}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57432 57432]
+
{{#set: taxonomic range=TAX-4751}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C06093 C06093]
+
{{#set: common name=trehalose degradation II (trehalase)}}
* HMDB : HMDB39484
+
{{#set: reaction found=2}}
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))}}
+
{{#set: total reaction=2}}
{{#set: inchi key=InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M}}
+
{{#set: completion rate=100.0}}
{{#set: common name=gibberellin A12-aldehyde}}
+
{{#set: molecular weight=315.431    }}
+
{{#set: common name=GA12-aldehyde}}
+
{{#set: consumed by=RXN1F-161}}
+
{{#set: produced by=RXN1F-160}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY0-1182

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links