Difference between revisions of "RXN-9725"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)N...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I
+
** [http://enzyme.expasy.org/EC/1.3.1.77 EC-1.3.1.77]
−
* common name:
+
−
** trans-2,3-dehydroadipyl-coA
+
−
* molecular weight:
+
−
** 888.606   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cis-2,3-didehydroadipyl-CoA
 
−
** 2,3-didehydroadipyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 3 [[PROTON]][c] '''+''' 1 [[CPD-591]][c] '''+''' 2 [[NADPH]][c] '''=>''' 2 [[NADP]][c] '''+''' 1 [[CPD-7630]][c]
−
* [[RXN-2425]]
+
* With common name(s):
 +
** 3 H+[c] '''+''' 1 cyanidin[c] '''+''' 2 NADPH[c] '''=>''' 2 NADP+[c] '''+''' 1 (-)-epicatechin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_001220]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-12_005240]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-12_001350]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6035]], 2,3-cis-flavanols biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926262 46926262]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06542 R06542]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.77}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67261 67261]
+
{{#set: gene associated=Ec-23_001220|Ec-12_005240|Ec-12_001350}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044]
+
{{#set: in pathway=PWY-6035}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144]
+
{{#set: reconstruction source=orthology-aragem}}
−
* HMDB : HMDB60392
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}}
+
−
{{#set: common name=trans-2,3-dehydroadipyl-coA}}
+
−
{{#set: molecular weight=888.606    }}
+
−
{{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-2425}}
+

Latest revision as of 19:06, 21 March 2018

Reaction RXN-9725

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 3 H+[c] + 1 cyanidin[c] + 2 NADPH[c] => 2 NADP+[c] + 1 (-)-epicatechin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6035, 2,3-cis-flavanols biosynthesis: PWY-6035
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9725&oldid=24572"