Difference between revisions of "CPD-714"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.77 EC-1.3.1.77]
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
 +
* common name:
 +
** cathasterone
 +
* molecular weight:
 +
** 432.685   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[NADPH]][c] '''+''' 3 [[PROTON]][c] '''+''' 1 [[CPD-591]][c] '''=>''' 2 [[NADP]][c] '''+''' 1 [[CPD-7630]][c]
+
* [[RXN-715]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 NADPH[c] '''+''' 3 H+[c] '''+''' 1 cyanidin[c] '''=>''' 2 NADP+[c] '''+''' 1 (-)-epicatechin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-23_001220]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-12_005240]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-12_001350]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-6035]], 2,3-cis-flavanols biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06542 R06542]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203118 25203118]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.3.1.77}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
−
{{#set: gene associated=Ec-23_001220|Ec-12_005240|Ec-12_001350}}
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: in pathway=PWY-6035}}
+
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=cathasterone}}
−
{{#set: reconstruction source=orthology-aragem}}
+
{{#set: molecular weight=432.685    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-715}}

Latest revision as of 19:06, 21 March 2018

Metabolite CPD-714

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
  • common name:
    • cathasterone
  • molecular weight:
    • 432.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-714&oldid=24600"