Difference between revisions of "CPD-11495"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])CC1(=CC=CC=C(O)1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.5.1 EC-3.5.5.1]
+
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
 +
* common name:
 +
** 2-hydroxyphenylacetate
 +
* molecular weight:
 +
** 151.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxyphenylacetic acid
 +
** benzeneacetic acid, 2-hydroxy-
 +
** 2-hydroxybenzeneacetic acid
 +
** acetic acid, (o-hydroxyphenyl)-
 +
** o-hydroxy phenylacetic acid
 +
** o-hydroxyphenylacetate
 +
** o-hydroxyphenylacetic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[WATER]][c] '''+''' 1 [[INDOLEYL-CPD]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
+
* [[RXN-10815]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H2O[c] '''+''' 1 indole-3-acetonitrile[c] '''=>''' 1 ammonium[c] '''+''' 1 indole-3-acetate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-26_000350]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-01_002370]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-581]], indole-3-acetate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581]
+
−
** '''2''' reactions found over '''14''' reactions in the full pathway
+
−
* [[PWY-5026]], indole-3-acetate biosynthesis V (bacteria and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWYQT-4476]], indole glucosinolate breakdown (insect chewing induced): [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476]
+
−
** '''1''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03093 R03093]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-3.5.5.1}}
+
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
−
{{#set: gene associated=Ec-26_000350|Ec-01_002370}}
+
* CHEBI:
−
{{#set: in pathway=PWY-581|PWY-5026|PWYQT-4476}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-aragem}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
−
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB00669
 +
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
 +
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
 +
{{#set: common name=2-hydroxyphenylacetate}}
 +
{{#set: molecular weight=151.141    }}
 +
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
 +
{{#set: produced by=RXN-10815}}

Latest revision as of 19:07, 21 March 2018

Metabolite CPD-11495

  • smiles:
    • C(=O)([O-])CC1(=CC=CC=C(O)1)
  • inchi key:
    • InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
  • common name:
    • 2-hydroxyphenylacetate
  • molecular weight:
    • 151.141
  • Synonym(s):
    • 2-hydroxyphenylacetic acid
    • benzeneacetic acid, 2-hydroxy-
    • 2-hydroxybenzeneacetic acid
    • acetic acid, (o-hydroxyphenyl)-
    • o-hydroxy phenylacetic acid
    • o-hydroxyphenylacetate
    • o-hydroxyphenylacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(=CC=CC=C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-11495&oldid=24630"