Difference between revisions of "UDP-SULFOQUINOVOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K |
* common name: | * common name: | ||
| − | ** | + | ** UDP-α-D-sulfoquinovopyranose |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 627.34 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** UDP-6-sulfoquinovose |
| − | ** | + | ** UDP-sulfoquinovose |
| − | ** | + | ** UDP-α-D-sulfoquinovose |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1224]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-1223]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200933 25200933] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60009 60009] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11521 C11521] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K}} |
| − | {{#set: molecular weight= | + | {{#set: common name=UDP-α-D-sulfoquinovopyranose}} |
| − | {{#set: common name= | + | {{#set: molecular weight=627.34 }} |
| − | {{#set: | + | {{#set: common name=UDP-6-sulfoquinovose|UDP-sulfoquinovose|UDP-α-D-sulfoquinovose}} |
| + | {{#set: consumed by=RXN-1224}} | ||
| + | {{#set: produced by=RXN-1223}} | ||
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite UDP-SULFOQUINOVOSE
- smiles:
- C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))
- inchi key:
- InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K
- common name:
- UDP-α-D-sulfoquinovopyranose
- molecular weight:
- 627.34
- Synonym(s):
- UDP-6-sulfoquinovose
- UDP-sulfoquinovose
- UDP-α-D-sulfoquinovose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.
