Difference between revisions of "P108-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * smiles: ** C(O)(C([O-])=O)NC(N)=O * inchi key: ** InChIKey=NWZYYCVIOKVT...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P108-PWY P108-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P108-PWY P108-PWY] ==
* smiles:
+
* taxonomic range:
** C(O)(C([O-])=O)NC(N)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
+
 
* common name:
 
* common name:
** S-ureidoglycolate
+
** pyruvate fermentation to propanoate I
* molecular weight:
+
** 133.083   
+
 
* Synonym(s):
 
* Synonym(s):
** (-)-ureidoglycolate
+
** succinate-propionate fermentation pathway
** ureidoglycolate
+
** pyruvate fermentation to propionate I
** S-(-)-ureidoglycolate
+
** succinate-propanoate fermentation pathway
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''7''' reactions in the full pathway
* [[ALLANTOICASE-RXN]]
+
* [[FUMHYDR-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-25_001360]]
 +
*** [[Ec-23_003460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.3.1-RXN 2.1.3.1-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-268 RXN0-268]
 
== External links  ==
 
== External links  ==
* CAS : 2017665
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=pyruvate fermentation to propanoate I}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615273 23615273]
+
{{#set: common name=succinate-propionate fermentation pathway|pyruvate fermentation to propionate I|succinate-propanoate fermentation pathway}}
* HMDB : HMDB01005
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=7}}
** [http://www.genome.jp/dbget-bin/www_bget?C00603 C00603]
+
{{#set: completion rate=29.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.19951218.html 19951218]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57296 57296]
+
* BIGG : 1483307
+
{{#set: smiles=C(O)(C([O-])=O)NC(N)=O}}
+
{{#set: inchi key=InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M}}
+
{{#set: common name=S-ureidoglycolate}}
+
{{#set: molecular weight=133.083    }}
+
{{#set: common name=(-)-ureidoglycolate|ureidoglycolate|S-(-)-ureidoglycolate}}
+
{{#set: produced by=ALLANTOICASE-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Pathway P108-PWY

  • taxonomic range:
  • common name:
    • pyruvate fermentation to propanoate I
  • Synonym(s):
    • succinate-propionate fermentation pathway
    • pyruvate fermentation to propionate I
    • succinate-propanoate fermentation pathway

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links