Difference between revisions of "CPD-3945"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (22α)-hydroxy-campest-4-en-3-one |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 414.67 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (22S)-22-hydroxy-campest-4-en-3-one |
+ | ** (22S,24R)-22-hydroxy-ergost-4-en-3-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-4231]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMST01031116 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201842 25201842] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796] |
− | * HMDB : | + | * HMDB : HMDB12113 |
− | {{#set: smiles= | + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=(22α)-hydroxy-campest-4-en-3-one}} |
− | {{#set: common name= | + | {{#set: molecular weight=414.67 }} |
− | {{#set: | + | {{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}} |
+ | {{#set: produced by=RXN-4231}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-3945
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
- common name:
- (22α)-hydroxy-campest-4-en-3-one
- molecular weight:
- 414.67
- Synonym(s):
- (22S)-22-hydroxy-campest-4-en-3-one
- (22S,24R)-22-hydroxy-ergost-4-en-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.