Difference between revisions of "CPD-18550"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_007000 == * left end position: ** 6310488 * transcription direction: ** NEGATIVE * right end position: ** 6324376 * centisome position: ** 75.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M |
| − | * | + | * common name: |
| − | ** | + | ** quinoxaline-2-carboxyl adenylate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 502.359 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17155]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}} |
| − | + | {{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}} | |
| − | + | {{#set: common name=quinoxaline-2-carboxyl adenylate}} | |
| − | {{#set: | + | {{#set: molecular weight=502.359 }} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-17155}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-18550
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
- inchi key:
- InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
- common name:
- quinoxaline-2-carboxyl adenylate
- molecular weight:
- 502.359
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.
