Difference between revisions of "INOPHOSPHOR-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expas...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.2.1 EC-2.4.2.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[Pi]][c] '''+''' 1 [[INOSINE]][c] '''<=>''' 1 [[HYPOXANTHINE]][c] '''+''' 1 [[RIBOSE-1P]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 phosphate[c] '''+''' 1 inosine[c] '''<=>''' 1 hypoxanthine[c] '''+''' 1 α-D-ribose-1-phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY0-1296]], purine ribonucleosides degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1296 PWY0-1296] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6609]], adenine and adenosine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6609 PWY-6609] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[SALVADEHYPOX-PWY]], adenosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27646 27646] |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01863 R01863] | |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.4.2.1}} |
− | + | {{#set: in pathway=PWY0-1296|PWY-6609|SALVADEHYPOX-PWY}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:08, 21 March 2018
Contents
Reaction INOPHOSPHOR-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Pi[c] + 1 INOSINE[c] <=> 1 HYPOXANTHINE[c] + 1 RIBOSE-1P[c]
- With common name(s):
- 1 phosphate[c] + 1 inosine[c] <=> 1 hypoxanthine[c] + 1 α-D-ribose-1-phosphate[c]
Genes associated with this reaction
Pathways
- PWY0-1296, purine ribonucleosides degradation: PWY0-1296
- 2 reactions found over 6 reactions in the full pathway
- PWY-6609, adenine and adenosine salvage III: PWY-6609
- 3 reactions found over 4 reactions in the full pathway
- SALVADEHYPOX-PWY, adenosine nucleotides degradation II: SALVADEHYPOX-PWY
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links