Difference between revisions of "ACYL-ACP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-ACP ACYL-ACP] == * common name: ** an acyl-[acyl-carrier protein] * Synonym(s): ** an acyl...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-ACP ACYL-ACP] ==
* smiles:
+
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
+
* inchi key:
+
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
+
 
* common name:
 
* common name:
** 7-dehydrocholesterol
+
** an acyl-[acyl-carrier protein]
* molecular weight:
+
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
** cholesta-5,7-dien-3 β-ol
+
** an acyl-ACP
** cholesta-5,7-dienol
+
** an acyl-[acp]
** 7-dehydro-cholesterol
+
** CH3(CH2)xCO-S-ACP
** cholesta-5,7-dien-3β-ol
+
** provitamin D3
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-323]]
+
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[RXN-10462]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.21.6-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[1.3.1.9-RXN]]
 +
* [[2.3.1.41-RXN]]
 
== External links  ==
 
== External links  ==
* CAS : 434-16-2
+
{{#set: common name=an acyl-[acyl-carrier protein]}}
* PUBCHEM:
+
{{#set: common name=an acyl-ACP|an acyl-[acp]|CH3(CH2)xCO-S-ACP}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201813 25201813]
+
{{#set: consumed by=1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN|RXN-10462}}
* CHEBI:
+
{{#set: reversible reaction associated=1.3.1.9-RXN|2.3.1.41-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
+
* HMDB : HMDB00032
+
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
+
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
+
{{#set: common name=7-dehydrocholesterol}}
+
{{#set: molecular weight=384.644    }}
+
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
+
{{#set: consumed by=RXN66-323}}
+
{{#set: produced by=1.14.21.6-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Metabolite ACYL-ACP

  • common name:
    • an acyl-[acyl-carrier protein]
  • Synonym(s):
    • an acyl-ACP
    • an acyl-[acp]
    • CH3(CH2)xCO-S-ACP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an acyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
"an acyl-[acp" cannot be used as a page name in this wiki.