Difference between revisions of "MONO-VINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-03_003570 == * left end position: ** 4035552 * transcription direction: ** POSITIVE * right end position: ** 4038930 * centisome position: ** 61.8...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-03_003570 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
−
* left end position:
+
* smiles:
−
** 4035552
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** protochlorophyllide a
−
* right end position:
+
* molecular weight:
−
** 4038930
+
** 610.951    
−
* centisome position:
+
−
** 61.81286    
+
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0223_0029
+
** monovinyl protochlorophyllide a
−
** Esi0223_0029
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[URACIL-PRIBOSYLTRANS-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
* [[RXN1F-10]]
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
−
* [[PWY-7183]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4035552}}
+
* CAS : 14751-08-7
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=4038930}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
−
{{#set: centisome position=61.81286   }}
+
* CHEBI:
−
{{#set: common name=Esi_0223_0029|Esi0223_0029}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
−
{{#set: reaction associated=URACIL-PRIBOSYLTRANS-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7183}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
 +
* HMDB : HMDB31148
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=protochlorophyllide a}}
 +
{{#set: molecular weight=610.951   }}
 +
{{#set: common name=monovinyl protochlorophyllide a}}
 +
{{#set: reversible reaction associated=RXN1F-10}}

Latest revision as of 19:08, 21 March 2018

Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • protochlorophyllide a
  • molecular weight:
    • 610.951
  • Synonym(s):
    • monovinyl protochlorophyllide a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MONO-VINYL-PROTOCHLOROPHYLLIDE-A&oldid=24838"