Difference between revisions of "CPD-11552"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_002580 == * left end position: ** 2449732 * transcription direction: ** POSITIVE * right end position: ** 2458006 * centisome position: ** 37.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 222.177 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10722]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[RXN-10721]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: reaction associated= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645] |
| + | * HMDB : HMDB04083 | ||
| + | {{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}} | ||
| + | {{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}} | ||
| + | {{#set: molecular weight=222.177 }} | ||
| + | {{#set: consumed by=RXN-10722}} | ||
| + | {{#set: reversible reaction associated=RXN-10721}} | ||
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-11552
- smiles:
- C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
- inchi key:
- InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
- common name:
- 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
- molecular weight:
- 222.177
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)" cannot be used as a page name in this wiki.
