Difference between revisions of "CPD-14115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == |
* smiles: | * smiles: | ||
− | ** | + | ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N |
* common name: | * common name: | ||
− | ** | + | ** (S)-equol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 242.274 |
* Synonym(s): | * Synonym(s): | ||
− | + | ** 4',7-isoflavandiol | |
− | ** 4- | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-15589]] |
== External links == | == External links == | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131] |
+ | * Wikipedia : Equol | ||
+ | * HMDB : HMDB02209 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741] |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469] |
− | + | {{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=(S)-equol}} |
− | {{#set: common name= | + | {{#set: molecular weight=242.274 }} |
− | {{#set: molecular weight= | + | {{#set: common name=4',7-isoflavandiol}} |
− | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-15589}} |
− | + | ||
− | {{#set: reversible reaction associated=RXN- | + |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-14115
- smiles:
- C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
- inchi key:
- InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
- common name:
- (S)-equol
- molecular weight:
- 242.274
- Synonym(s):
- 4',7-isoflavandiol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links