Difference between revisions of "CPD-313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-313 CPD-313] == * smiles: ** C(CC[N+])[N+] * inchi key: ** InChIKey=XFNJVJPLKCPIBV-UHFFFAOY...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-313 CPD-313] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(CC[N+])[N+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XFNJVJPLKCPIBV-UHFFFAOYSA-P |
* common name: | * common name: | ||
| − | ** | + | ** propane-1,3-diamine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 76.141 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trimethylenediamine |
| − | ** | + | ** 1,3-propanediamine |
| − | ** | + | ** 1,3-diaminopropane |
| − | ** | + | ** 1,3-DAP |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-6381]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13415]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.5.1.46-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * CAS : 109-76-2 |
| − | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4030255 4030255] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB00002 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: consumed by=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00986 C00986] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3247103.html 3247103] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57484 57484] | ||
| + | * METABOLIGHTS : MTBLC57484 | ||
| + | {{#set: smiles=C(CC[N+])[N+]}} | ||
| + | {{#set: inchi key=InChIKey=XFNJVJPLKCPIBV-UHFFFAOYSA-P}} | ||
| + | {{#set: common name=propane-1,3-diamine}} | ||
| + | {{#set: molecular weight=76.141 }} | ||
| + | {{#set: common name=trimethylenediamine|1,3-propanediamine|1,3-diaminopropane|1,3-DAP}} | ||
| + | {{#set: consumed by=RXN-6381}} | ||
| + | {{#set: produced by=RXN-13415}} | ||
| + | {{#set: reversible reaction associated=2.5.1.46-RXN}} | ||
Latest revision as of 19:09, 21 March 2018
Contents
Metabolite CPD-313
- smiles:
- C(CC[N+])[N+]
- inchi key:
- InChIKey=XFNJVJPLKCPIBV-UHFFFAOYSA-P
- common name:
- propane-1,3-diamine
- molecular weight:
- 76.141
- Synonym(s):
- trimethylenediamine
- 1,3-propanediamine
- 1,3-diaminopropane
- 1,3-DAP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 109-76-2
- PUBCHEM:
- HMDB : HMDB00002
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57484
"C(CC[N+])[N+" cannot be used as a page name in this wiki.
