Difference between revisions of "PWY-4061"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 
* common name:
 
* common name:
** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
+
** glutathione-mediated detoxification I
* inchi key:
+
** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
+
* molecular weight:
+
** 1051.975   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16097]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GSHTRAN-RXN]]
* [[RXN-16096]]
+
** 20 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-00_000320]]
 +
*** [[Ec-27_000390]]
 +
*** [[Ec-20_001950]]
 +
*** [[Ec-00_008380]]
 +
*** [[Ec-00_008370]]
 +
*** [[Ec-09_003670]]
 +
*** [[Ec-13_002370]]
 +
*** [[Ec-24_001030]]
 +
*** [[Ec-13_000340]]
 +
*** [[Ec-06_002520]]
 +
*** [[Ec-00_008890]]
 +
*** [[Ec-16_001680]]
 +
*** [[Ec-27_000400]]
 +
*** [[Ec-00_008360]]
 +
*** [[Ec-06_008030]]
 +
*** [[Ec-18_001510]]
 +
*** [[Ec-13_002360]]
 +
*** [[Ec-00_008870]]
 +
*** [[Ec-11_002590]]
 +
*** [[Ec-10_001330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-6642]]
 +
** 1 associated gene(s):
 +
*** [[Ec-09_003180]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.80-RXN 2.3.1.80-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6641 RXN-6641]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6763 RXN-6763]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33154}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765]
+
{{#set: common name=glutathione-mediated detoxification I}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409]
+
{{#set: total reaction=5}}
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: completion rate=40.0}}
{{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}}
+
{{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}}
+
{{#set: molecular weight=1051.975    }}
+
{{#set: consumed by=RXN-16097}}
+
{{#set: produced by=RXN-16096}}
+

Latest revision as of 19:09, 21 March 2018

Pathway PWY-4061

  • taxonomic range:
  • common name:
    • glutathione-mediated detoxification I
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links