Difference between revisions of "Ec-05 000950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
(Created page with "Category:Gene == Gene Ec-05_000950 == * left end position: ** 2071506 * transcription direction: ** POSITIVE * right end position: ** 2084568 * centisome position: ** 22.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Gene Ec-05_000950 ==
−
* smiles:
+
* left end position:
−
** C(C1(C=C(C(=CC=1)O)O))=O
+
** 2071506
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** protocatechualdehyde
+
** 2084568
−
* molecular weight:
+
* centisome position:
−
** 138.123    
+
** 22.755041    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxybenzaldehyde
+
** Esi_0169_0029
−
** 3,4-dihydroxybenzyl aldehyde
+
** Esi0169_0029
−
** rancinamycin IV
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[5-NUCLEOTID-RXN]]
−
* [[RXN-8872]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[AMP-DEPHOSPHORYLATION-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14025]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14026]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14227]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-5841]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7607]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7609]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[XMPXAN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5381]]
 +
* [[PWY-6607]]
 +
* [[PWY-7185]]
 +
* [[SALVADEHYPOX-PWY]]
 +
* [[PWY-6596]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 +
* [[PWY-6606]]
 +
* [[PWY-6608]]
 +
* [[PWY-5695]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2071506}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=2084568}}
−
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
{{#set: centisome position=22.755041   }}
−
* CHEBI:
+
{{#set: common name=Esi_0169_0029|Esi0169_0029}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
{{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
−
* HMDB : HMDB59965
+
−
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
−
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
−
{{#set: common name=protocatechualdehyde}}
+
−
{{#set: molecular weight=138.123   }}
+
−
{{#set: common name=3,4-dihydroxybenzaldehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
−
{{#set: produced by=RXN-8872}}
+

Latest revision as of 19:10, 21 March 2018

Gene Ec-05_000950

  • left end position:
    • 2071506
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2084568
  • centisome position:
    • 22.755041
  • Synonym(s):
    • Esi_0169_0029
    • Esi0169_0029

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_000950&oldid=24984"