Difference between revisions of "Ec-02 004080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...") |
(Created page with "Category:Gene == Gene Ec-02_004080 == * left end position: ** 4395180 * transcription direction: ** NEGATIVE * right end position: ** 4407628 * centisome position: ** 67.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_004080 == |
− | * | + | * left end position: |
− | ** | + | ** 4395180 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4407628 |
− | * | + | * centisome position: |
− | ** | + | ** 67.330284 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0041_0152 |
− | ** | + | ** Esi0041_0152 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.4.1.223-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-6558]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4395180}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4407628}} | |
− | + | {{#set: centisome position=67.330284 }} | |
− | + | {{#set: common name=Esi_0041_0152|Esi0041_0152}} | |
− | + | {{#set: reaction associated=2.4.1.223-RXN}} | |
− | + | {{#set: pathway associated=PWY-6558}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:07, 21 March 2018
Gene Ec-02_004080
- left end position:
- 4395180
- transcription direction:
- NEGATIVE
- right end position:
- 4407628
- centisome position:
- 67.330284
- Synonym(s):
- Esi_0041_0152
- Esi0041_0152
Reactions associated
- Reaction: 2.4.1.223-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome