Difference between revisions of "CPD-7616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-Ribosyl-Acceptors ADP-D-Ribosyl-Acceptors] == * common name: ** an ADP-D-ribosyl acceptor...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == |
+ | * smiles: | ||
+ | ** C(C1(C=C(C(=CC=1)O)O))=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** protocatechualdehyde |
+ | * molecular weight: | ||
+ | ** 138.123 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3,4-dihydroxybenzaldehyde | ||
+ | ** 3,4-dihydroxybenzyl aldehyde | ||
+ | ** rancinamycin IV | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8872]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.8438.html 8438] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700] | ||
+ | * HMDB : HMDB59965 | ||
+ | {{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}} | ||
+ | {{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=protocatechualdehyde}} | ||
+ | {{#set: molecular weight=138.123 }} | ||
+ | {{#set: common name=3,4-dihydroxybenzaldehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}} | ||
+ | {{#set: produced by=RXN-8872}} |
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite CPD-7616
- smiles:
- C(C1(C=C(C(=CC=1)O)O))=O
- inchi key:
- InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
- common name:
- protocatechualdehyde
- molecular weight:
- 138.123
- Synonym(s):
- 3,4-dihydroxybenzaldehyde
- 3,4-dihydroxybenzyl aldehyde
- rancinamycin IV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links