Difference between revisions of "RXN-13202"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-3-PHOSPHATE-CYCLASE-RXN RNA-3-PHOSPHATE-CYCLASE-RXN] == * direction: ** LEFT-TO-RIGHT * common...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-3-PHOSPHATE-CYCLASE-RXN RNA-3-PHOSPHATE-CYCLASE-RXN] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** RNA 3'-terminal phosphate cyclase domain |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/6.5.1.4 EC-6.5.1.4] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[3-Prime-Phosphate-Terminated-RNAs]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[Cyclic-Phosphate-Terminated-RNAs]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an RNA 3'-terminal-phosphate[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 an RNA terminal-2',3'-cyclic-phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-10_001150]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04274 R04274] |
| − | * | + | * UNIPROT: |
| − | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9V0Z6 Q9V0Z6] |
| − | + | ** [http://www.uniprot.org/uniprot/O00442 O00442] | |
| − | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=RNA 3'-terminal phosphate cyclase domain}} | |
| − | + | {{#set: ec number=EC-6.5.1.4}} | |
| − | + | {{#set: gene associated=Ec-10_001150}} | |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
Revision as of 13:18, 21 March 2018
Contents
Reaction RNA-3-PHOSPHATE-CYCLASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- RNA 3'-terminal phosphate cyclase domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-Prime-Phosphate-Terminated-RNAs[c] + 1 ATP[c] => 1 PPI[c] + 1 AMP[c] + 1 Cyclic-Phosphate-Terminated-RNAs[c]
- With common name(s):
- 1 an RNA 3'-terminal-phosphate[c] + 1 ATP[c] => 1 diphosphate[c] + 1 AMP[c] + 1 an RNA terminal-2',3'-cyclic-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_001150
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
