Difference between revisions of "3.6.4.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_ZN+2 TransportSeed_ZN+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_ZN+2 TransportSeed_ZN+2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(C=C(C(=CC=1)O)O))=O
 +
* inchi key:
 +
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
 +
* common name:
 +
** protocatechualdehyde
 +
* molecular weight:
 +
** 138.123   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-dihydroxybenzaldehyde
 +
** 3,4-dihydroxybenzyl aldehyde
 +
** rancinamycin IV
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[ZN+2]][e] '''=>''' 1.0 [[ZN+2]][c]
+
* [[RXN-8872]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 Zn2+[e] '''=>''' 1.0 Zn2+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[manual]]
+
−
** Source: [[manual-import_from_medium]]
+
−
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
−
{{#set: reconstruction category=manual}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=manual-import_from_medium}}
+
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
−
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
 +
* HMDB : HMDB59965
 +
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
 +
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
 +
{{#set: common name=protocatechualdehyde}}
 +
{{#set: molecular weight=138.123    }}
 +
{{#set: common name=3,4-dihydroxybenzaldehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
 +
{{#set: produced by=RXN-8872}}

Revision as of 13:19, 21 March 2018

Metabolite CPD-7616

  • smiles:
    • C(C1(C=C(C(=CC=1)O)O))=O
  • inchi key:
    • InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
  • common name:
    • protocatechualdehyde
  • molecular weight:
    • 138.123
  • Synonym(s):
    • 3,4-dihydroxybenzaldehyde
    • 3,4-dihydroxybenzyl aldehyde
    • rancinamycin IV

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.6.4.4-RXN&oldid=17529"