Difference between revisions of "GUANOSINE-DIPHOSPHATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** putrescine biosynthesis IV |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** putrescine biosynthesis in plants | ||
+ | ** ODC and ADC putrescine biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[AGMATIN-RXN]] | |
− | == Reaction(s) | + | ** 3 associated gene(s): |
− | * [ | + | *** [[Ec-17_004300]] |
+ | *** [[Ec-22_003700]] | ||
+ | *** [[Ec-17_004310]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ARGINASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-10_001100]] | ||
+ | *** [[Ec-22_003700]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[ORNDECARBOX-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-11_003270]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=putrescine biosynthesis IV}} | |
− | + | {{#set: common name=putrescine biosynthesis in plants|ODC and ADC putrescine biosynthesis}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=75.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:19, 21 March 2018
Pathway PWY-6305
- taxonomic range:
- common name:
- putrescine biosynthesis IV
- Synonym(s):
- putrescine biosynthesis in plants
- ODC and ADC putrescine biosynthesis
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- AGMATIN-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- ARGINASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- ORNDECARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: