Difference between revisions of "PWY-5122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Gene == Gene Ec-05_001470 == * left end position: ** 2772513 * transcription direction: ** POSITIVE * right end position: ** 2778522 * centisome position: ** 30.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_001470 == |
− | * | + | * left end position: |
− | ** | + | ** 2772513 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2778522 |
− | * | + | * centisome position: |
− | ** | + | ** 30.45545 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0114_0055 |
− | ** | + | ** Esi0114_0055 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2772513}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2778522}} | |
− | + | {{#set: centisome position=30.45545 }} | |
− | + | {{#set: common name=Esi_0114_0055|Esi0114_0055}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 13:19, 21 March 2018
Gene Ec-05_001470
- left end position:
- 2772513
- transcription direction:
- POSITIVE
- right end position:
- 2778522
- centisome position:
- 30.45545
- Synonym(s):
- Esi_0114_0055
- Esi0114_0055
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome