Difference between revisions of "RXN-5822"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-26_002630 == * left end position: ** 2932117 * transcription direction: ** POSITIVE * right end position: ** 2935774 * centisome position: ** 44.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_002630 == |
− | * | + | * left end position: |
− | ** | + | ** 2932117 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2935774 |
− | * | + | * centisome position: |
− | ** | + | ** 44.538387 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0212_0059 | ||
+ | ** Esi0212_0059 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[LYSOPHOSPHOLIPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-15035]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7409]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2932117}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2935774}} | |
− | {{#set: | + | {{#set: centisome position=44.538387 }} |
− | {{#set: | + | {{#set: common name=Esi_0212_0059|Esi0212_0059}} |
− | {{#set: common name= | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7409}} |
− | {{#set: | + |
Revision as of 13:20, 21 March 2018
Gene Ec-26_002630
- left end position:
- 2932117
- transcription direction:
- POSITIVE
- right end position:
- 2935774
- centisome position:
- 44.538387
- Synonym(s):
- Esi_0212_0059
- Esi0212_0059
Reactions associated
- Reaction: LYSOPHOSPHOLIPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15035
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome