Difference between revisions of "RXN-5822"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...")
(Created page with "Category:Gene == Gene Ec-26_002630 == * left end position: ** 2932117 * transcription direction: ** POSITIVE * right end position: ** 2935774 * centisome position: ** 44.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] ==
+
== Gene Ec-26_002630 ==
−
* smiles:
+
* left end position:
−
** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))
+
** 2932117
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N'-hydroxymethyl-norcotinine
+
** 2935774
−
* molecular weight:
+
* centisome position:
−
** 192.217    
+
** 44.538387    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0212_0059
 +
** Esi0212_0059
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
−
* [[RXN66-169]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2932117}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201488 25201488]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB01324
+
{{#set: right end position=2935774}}
−
{{#set: smiles=C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))}}
+
{{#set: centisome position=44.538387    }}
−
{{#set: inchi key=InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N}}
+
{{#set: common name=Esi_0212_0059|Esi0212_0059}}
−
{{#set: common name=N'-hydroxymethyl-norcotinine}}
+
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
−
{{#set: molecular weight=192.217    }}
+
{{#set: pathway associated=PWY-7409}}
−
{{#set: produced by=RXN66-169}}
+

Revision as of 13:20, 21 March 2018

Gene Ec-26_002630

  • left end position:
    • 2932117
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2935774
  • centisome position:
    • 44.538387
  • Synonym(s):
    • Esi_0212_0059
    • Esi0212_0059

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-5822&oldid=17669"