Difference between revisions of "ARYLSULFAT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6349 PWY-6349] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6349 PWY-6349] ==
* smiles:
+
* taxonomic range:
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** myricetin
+
** CDP-archaeol biosynthesis
* molecular weight:
+
** 317.231   
+
 
* Synonym(s):
 
* Synonym(s):
** myricitin
 
** cannabiscetin
 
** myricetol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[RXN-8450]]
+
* [[2.5.1.41-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-07_006170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.261-RXN 1.1.1.261-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.42-RXN 2.5.1.42-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14399 RXN-14399]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14400 RXN-14400]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9995 RXN-9995]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
+
{{#set: common name=CDP-archaeol biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=17.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
+
* HMDB : HMDB02755
+
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
+
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
+
{{#set: common name=myricetin}}
+
{{#set: molecular weight=317.231    }}
+
{{#set: common name=myricitin|cannabiscetin|myricetol}}
+
{{#set: produced by=RXN-8450}}
+

Revision as of 13:20, 21 March 2018

Pathway PWY-6349

  • taxonomic range:
  • common name:
    • CDP-archaeol biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links