Difference between revisions of "Ec-21 003610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLX-tRNAs GLX-tRNAs] == * common name: ** a tRNAGlx * Synonym(s): == Reaction(s) known to cons...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLX-tRNAs GLX-tRNAs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a tRNAGlx |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6.1.1.24-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a tRNAGlx}} | |
| − | + | {{#set: consumed by=6.1.1.24-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Revision as of 13:20, 21 March 2018
Contents
Metabolite GLX-tRNAs
- common name:
- a tRNAGlx
- Synonym(s):
