Difference between revisions of "Ec-07 004500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HYDROXYPHYTANOYL-COA 2-HYDROXYPHYTANOYL-COA] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == * direction: ** LEFT-TO-RIGHT * common name: ** 14-oxolanosterol deformylas...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HYDROXYPHYTANOYL-COA 2-HYDROXYPHYTANOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WNVFJMYPVBOLKV-YLNUKALLSA-J
+
 
* common name:
 
* common name:
** 2-hydroxyphytanoyl-CoA
+
** 14-oxolanosterol deformylase
* molecular weight:
+
** Cytochrome P450
** 1074.021   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[1.14.11.18-RXN]]
+
** 1 [[CPD-4573]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[FORMATE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 14-oxolanosterol[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] '''+''' 1 formate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C07343 C07343]
+
{{#set: common name=14-oxolanosterol deformylase}}
* CHEBI:
+
{{#set: common name=Cytochrome P450}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57334 57334]
+
{{#set: gene associated=Ec-10_006240}}
* METABOLIGHTS : MTBLC57334
+
{{#set: in pathway=PWY66-341|PWY66-4}}
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266567 45266567]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* HMDB : HMDB01295
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=WNVFJMYPVBOLKV-YLNUKALLSA-J}}
+
{{#set: common name=2-hydroxyphytanoyl-CoA}}
+
{{#set: molecular weight=1074.021    }}
+
{{#set: produced by=1.14.11.18-RXN}}
+

Revision as of 14:20, 21 March 2018

Reaction RXN66-305

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 14-oxolanosterol deformylase
    • Cytochrome P450
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-341, cholesterol biosynthesis I: PWY66-341
    • 9 reactions found over 22 reactions in the full pathway
  • PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
    • 9 reactions found over 22 reactions in the full pathway

Reconstruction information

External links