Difference between revisions of "Ec-11 005720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_003940 == * left end position: ** 3298248 * transcription direction: ** POSITIVE * right end position: ** 3300953 * centisome position: ** 31.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-01_003940 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
* left end position:
+
* smiles:
** 3298248
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
* right end position:
+
* common name:
** 3300953
+
** 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
* centisome position:
+
* molecular weight:
** 31.963379    
+
** 927.663    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0003_0344
+
** 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA
** Esi0003_0344
+
** PK
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-11245]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***go-term
+
* [[RXN-11244]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=3298248}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173446 46173446]
{{#set: right end position=3300953}}
+
* CHEBI:
{{#set: centisome position=31.963379   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73549 73549]
{{#set: common name=Esi_0003_0344|Esi0003_0344|PK}}
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
{{#set: inchi key=InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J}}
 +
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA}}
 +
{{#set: molecular weight=927.663   }}
 +
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA}}
 +
{{#set: consumed by=RXN-11245}}
 +
{{#set: produced by=RXN-11244}}

Revision as of 14:21, 21 March 2018

Metabolite CPD-12199

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • inchi key:
    • InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
  • common name:
    • 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
  • molecular weight:
    • 927.663
  • Synonym(s):
    • 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.