Difference between revisions of "STRICTOSIDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] == * smiles: ** C1(O)(C(OP([O-])([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * smiles: ** C(=O)([O-])CNC(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M |
* common name: | * common name: | ||
| − | ** | + | ** 2,4-dinitrophenyl-S-glutathione |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 472.406 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** DNP-SG |
| − | ** | + | ** S-(2,4-dinitrophenyl)glutathione |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GST-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25322932 25322932] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8927 8927] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11175 C11175] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=2,4-dinitrophenyl-S-glutathione}} |
| − | {{#set: common name= | + | {{#set: molecular weight=472.406 }} |
| − | {{#set: | + | {{#set: common name=DNP-SG|S-(2,4-dinitrophenyl)glutathione}} |
| − | + | {{#set: reversible reaction associated=GST-RXN}} | |
Revision as of 13:21, 21 March 2018
Contents
Metabolite S-24-DINITROPHENYLGLUTATHIONE
- smiles:
- C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)
- inchi key:
- InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M
- common name:
- 2,4-dinitrophenyl-S-glutathione
- molecular weight:
- 472.406
- Synonym(s):
- DNP-SG
- S-(2,4-dinitrophenyl)glutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)" cannot be used as a page name in this wiki.
