Difference between revisions of "LysW-L-glutamate"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UGD-RXN UGD-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** UDP-glucose 6-dehydrogenase * e...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) |
+ | * inchi key: | ||
+ | ** InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** dopaquinone |
− | * | + | * molecular weight: |
− | ** | + | ** 195.174 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-11369]] |
− | + | * [[RXN-8483]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13061]] | |
− | + | * [[MONOPHENOL-MONOOXYGENASE-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00822 C00822] | |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57924 57924] |
− | * | + | * METABOLIGHTS : MTBLC57924 |
− | ** [http://www. | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229226 44229226] | |
− | * | + | * HMDB : HMDB01229 |
− | * | + | {{#set: smiles=C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)}} |
− | ** [http:// | + | {{#set: inchi key=InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N}} |
− | + | {{#set: common name=dopaquinone}} | |
− | + | {{#set: molecular weight=195.174 }} | |
− | * | + | {{#set: consumed by=RXN-11369|RXN-8483}} |
− | {{#set: | + | {{#set: produced by=RXN-13061|MONOPHENOL-MONOOXYGENASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 13:23, 21 March 2018
Contents
Metabolite DOPAQUINONE
- smiles:
- C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)
- inchi key:
- InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N
- common name:
- dopaquinone
- molecular weight:
- 195.174
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)" cannot be used as a page name in this wiki.