Difference between revisions of "AMINOPARATHION-PHOSPHATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Ec-01_008240 == * left end position: ** 7044345 * transcription direction: ** POSITIVE * right end position: ** 7052742 * centisome position: ** 68.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_008240 == |
− | * | + | * left end position: |
− | ** | + | ** 7044345 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7052742 |
− | * | + | * centisome position: |
− | ** | + | ** 68.26687 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0002_0034 | ||
+ | ** Esi0002_0034 | ||
+ | ** FTSZ | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5462]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=7044345}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7052742}} | |
− | + | {{#set: centisome position=68.26687 }} | |
− | + | {{#set: common name=Esi_0002_0034|Esi0002_0034|FTSZ}} | |
− | + | {{#set: reaction associated=RXN0-5462}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:23, 21 March 2018
Gene Ec-01_008240
- left end position:
- 7044345
- transcription direction:
- POSITIVE
- right end position:
- 7052742
- centisome position:
- 68.26687
- Synonym(s):
- Esi_0002_0034
- Esi0002_0034
- FTSZ
Reactions associated
- Reaction: RXN0-5462
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome