Difference between revisions of "CPD-7006"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** CDP-diacylglycerol biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CDP-diacylglycerol biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''4''' reactions found over '''4''' reactions in the full pathway |
− | * [[ | + | * [[CDPDIGLYSYN-RXN]] |
− | * [[ | + | ** 6 associated gene(s): |
− | + | *** [[Ec-16_001970]] | |
− | * [[ | + | *** [[Ec-14_002980]] |
− | + | *** [[Ec-17_000480]] | |
− | * [[ | + | *** [[Ec-15_001900]] |
− | * [[ | + | *** [[Ec-05_001740]] |
− | * [[ | + | *** [[Ec-14_003790]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-esiliculosus_genome]] |
− | * [[ | + | * [[GLYC3PDEHYDROGBIOSYN-RXN]] |
− | * [[ | + | ** 3 associated gene(s): |
+ | *** [[Ec-27_006990]] | ||
+ | *** [[Ec-19_001930]] | ||
+ | *** [[Ec-19_004200]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-1381]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_003960]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-1623]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-02_006160]] | ||
+ | *** [[Ec-12_004670]] | ||
+ | *** [[Ec-21_003240]] | ||
+ | *** [[Ec-26_001280]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5667 PWY-5667] | |
− | ** [http:// | + | * METACYC: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=PWY-5667 PWY-5667] | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | * | + | {{#set: common name=CDP-diacylglycerol biosynthesis I}} |
− | ** [http:// | + | {{#set: common name=CDP-diacylglycerol biosynthesis}} |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:23, 21 March 2018
Pathway PWY-5667
- taxonomic range:
- common name:
- CDP-diacylglycerol biosynthesis I
- Synonym(s):
- CDP-diacylglycerol biosynthesis
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- CDPDIGLYSYN-RXN
- 6 associated gene(s):
- 1 reconstruction source(s) associated:
- GLYC3PDEHYDROGBIOSYN-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-1381
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-1623
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links