Difference between revisions of "PWY-7158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC...")
(Created page with "Category:Gene == Gene Ec-12_000950 == * left end position: ** 934572 * transcription direction: ** NEGATIVE * right end position: ** 943502 * centisome position: ** 11.211...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] ==
+
== Gene Ec-12_000950 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 934572
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
+
** 943502
−
* molecular weight:
+
* centisome position:
−
** 441.673    
+
** 11.211206    
 
* Synonym(s):
 
* Synonym(s):
−
** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
+
** Esi_0193_0055
−
** 4β-methylzymosterol-4α-carboxylate
+
** Esi0193_0055
 +
** PYK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-313]]
+
* Reaction: [[PEPDEPHOS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-14117]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14192]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14207]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[GLYCOLYSIS]]
 +
* [[NPGLUCAT-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-7383]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-5723]]
 +
* [[FERMENTATION-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[PWY-6901]]
 +
* [[PWY-6142]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=934572}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657655 90657655]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=943502}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925]
+
{{#set: centisome position=11.211206    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0193_0055|Esi0193_0055|PYK}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808]
+
{{#set: reaction associated=PEPDEPHOS-RXN|RXN-14117|RXN-14192|RXN-14207}}
−
* HMDB : HMDB06927
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLYCOLYSIS|NPGLUCAT-PWY|PWY-7218|PWY-7383|P124-PWY|PWY-6886|PWY-5723|FERMENTATION-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|PWY-6901|PWY-6142|P122-PWY|PWY-7003}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}}
+
−
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: molecular weight=441.673    }}
+
−
{{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}}
+
−
{{#set: consumed by=RXN66-313}}
+

Revision as of 13:24, 21 March 2018

Gene Ec-12_000950

  • left end position:
    • 934572
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 943502
  • centisome position:
    • 11.211206
  • Synonym(s):
    • Esi_0193_0055
    • Esi0193_0055
    • PYK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7158&oldid=18255"