Difference between revisions of "HOMO-SER"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-13_002060 == * left end position: ** 3576854 * transcription direction: ** POSITIVE * right end position: ** 3626005 * centisome position: ** 51.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_002060 == |
− | * | + | * left end position: |
− | ** | + | ** 3576854 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3626005 |
− | * | + | * centisome position: |
− | ** | + | ** 51.567425 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0285_0010 |
− | ** | + | ** Esi0285_0010 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.1.3.16-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=3576854}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3626005}} | |
− | + | {{#set: centisome position=51.567425 }} | |
− | + | {{#set: common name=Esi_0285_0010|Esi0285_0010}} | |
− | + | {{#set: reaction associated=3.1.3.16-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:24, 21 March 2018
Gene Ec-13_002060
- left end position:
- 3576854
- transcription direction:
- POSITIVE
- right end position:
- 3626005
- centisome position:
- 51.567425
- Synonym(s):
- Esi_0285_0010
- Esi0285_0010
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome