Difference between revisions of "RXN-16475"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M |
* common name: | * common name: | ||
| − | ** | + | ** CDP-choline |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 487.319 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** citicoline |
| + | ** citicholine | ||
| + | ** cidifos | ||
| + | ** cyticholine | ||
| + | ** cytidine 5'-diphosphocholine | ||
| + | ** cytidine diphosphate choline | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.7.15-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-5781]] | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 987-78-0 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307] |
| − | {{#set: smiles= | + | * HMDB : HMDB01413 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=CDP-choline}} |
| − | {{#set: common name= | + | {{#set: molecular weight=487.319 }} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}} |
| + | {{#set: produced by=2.7.7.15-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-5781}} | ||
Revision as of 13:24, 21 March 2018
Contents
Metabolite CDP-CHOLINE
- smiles:
- C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
- inchi key:
- InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
- common name:
- CDP-choline
- molecular weight:
- 487.319
- Synonym(s):
- citicoline
- citicholine
- cidifos
- cyticholine
- cytidine 5'-diphosphocholine
- cytidine diphosphate choline
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))" cannot be used as a page name in this wiki.
