Difference between revisions of "ORNDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JCZF...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5710 PWY-5710] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-40...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5710 PWY-5710] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-4070] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** capsaicin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** capsaicinoids biosynthesis |
| + | ** hot pepper biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
| − | * [[ | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-28_003750]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.1.2.41-RXN 4.1.2.41-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.101-RXN 4.2.1.101-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8925 RXN-8925] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8926 RXN-8926] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8927 RXN-8927] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4070}} | |
| − | + | {{#set: common name=capsaicin biosynthesis}} | |
| − | + | {{#set: common name=capsaicinoids biosynthesis|hot pepper biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=6}} |
| − | {{#set: | + | {{#set: completion rate=17.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:25, 21 March 2018
Pathway PWY-5710
- taxonomic range:
- common name:
- capsaicin biosynthesis
- Synonym(s):
- capsaicinoids biosynthesis
- hot pepper biosynthesis
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
