Difference between revisions of "Ec-25 003740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN METHIONYL-TRNA-FORMYLTRANSFERASE-RXN] == * direction: ** LEFT-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN METHIONYL-TRNA-FORMYLTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Formyl transferase, C-terminal |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.2.9 EC-2.1.2.9] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[L-methionyl-tRNAfmet]][c] '''=>''' 1 [[THF-GLU-N]][c] '''+''' 1 [[N-formyl-L-methionyl-tRNAfmet]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 an L-methionyl-[initiator tRNAmet][c] '''=>''' 1 a tetrahydrofolate[c] '''+''' 1 an N-formyl-L-methionyl-[initiator tRNAmet][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-11_006140]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03940 R03940] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P94463 P94463] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PJ28 Q9PJ28] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P50932 P50932] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P47605 P47605] |
+ | ** [http://www.uniprot.org/uniprot/P44787 P44787] | ||
+ | ** [http://www.uniprot.org/uniprot/P56461 P56461] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9CEE9 Q9CEE9] | ||
+ | ** [http://www.uniprot.org/uniprot/O51091 O51091] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JWY9 Q9JWY9] | ||
+ | ** [http://www.uniprot.org/uniprot/P23882 P23882] | ||
+ | ** [http://www.uniprot.org/uniprot/P32785 P32785] | ||
+ | ** [http://www.uniprot.org/uniprot/P75235 P75235] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55163 Q55163] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Formyl transferase, C-terminal}} | ||
+ | {{#set: ec number=EC-2.1.2.9}} | ||
+ | {{#set: gene associated=Ec-11_006140}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:25, 21 March 2018
Contents
Reaction METHIONYL-TRNA-FORMYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Formyl transferase, C-terminal
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FORMYL-THF-GLU-N[c] + 1 L-methionyl-tRNAfmet[c] => 1 THF-GLU-N[c] + 1 N-formyl-L-methionyl-tRNAfmet[c]
- With common name(s):
- 1 an N10-formyl-tetrahydrofolate[c] + 1 an L-methionyl-[initiator tRNAmet][c] => 1 a tetrahydrofolate[c] + 1 an N-formyl-L-methionyl-[initiator tRNAmet][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-11_006140
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
- UNIPROT: