Difference between revisions of "Ec-00 004510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-01_008790 == * left end position: ** 7462582 * transcription direction: ** POSITIVE * right end position: ** 7466172 * centisome position: ** 72.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_008790 == |
− | * | + | * left end position: |
− | ** | + | ** 7462582 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7466172 |
− | * | + | * centisome position: |
− | ** | + | ** 72.320015 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0203_0002 |
+ | ** Esi0203_0002 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * | + | == Pathways associated == |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7462582}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7466172}} | |
− | + | {{#set: centisome position=72.320015 }} | |
− | + | {{#set: common name=Esi_0203_0002|Esi0203_0002}} | |
− | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 13:25, 21 March 2018
Gene Ec-01_008790
- left end position:
- 7462582
- transcription direction:
- POSITIVE
- right end position:
- 7466172
- centisome position:
- 72.320015
- Synonym(s):
- Esi_0203_0002
- Esi0203_0002
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome