Difference between revisions of "RXN-9674"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186801 TAX-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186801 TAX-186801] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** pyruvate fermentation to butanol I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''8''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Ec-26_003940]] | ||
| + | *** [[Ec-24_000870]] | ||
| + | *** [[Ec-22_002850]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[PYRUFLAVREDUCT-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Ec-18_003420]] | ||
| + | *** [[Ec-15_004230]] | ||
| + | *** [[Ec-23_002710]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-11662]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Ec-19_005290]] | ||
| + | *** [[Ec-14_006530]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXN-11667]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Ec-17_000320]] | ||
| + | *** [[Ec-14_006530]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=BUTANAL-DEHYDROGENASE-RXN BUTANAL-DEHYDROGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ENZRXN-201-RXN ENZRXN-201-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-161 RXN-161] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-186801}} | |
| − | + | {{#set: common name=pyruvate fermentation to butanol I}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:25, 21 March 2018
Pathway PWY-6583
- taxonomic range:
- common name:
- pyruvate fermentation to butanol I
- Synonym(s):
Reaction(s) found
4 reactions found over 8 reactions in the full pathway
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- PYRUFLAVREDUCT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11662
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-11667
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
