Difference between revisions of "MALATE-ASPARTATE-SHUTTLE-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200918 TAX-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344] ==
−
* smiles:
+
* taxonomic range:
−
** C(C1(=CC=CC=C1O))([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200918 TAX-200918]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
−
** InChIKey=YGSDEFSMJLZEOE-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
 
* common name:
 
* common name:
−
** salicylate
+
** L-ornithine degradation II (Stickland reaction)
−
* molecular weight:
+
−
** 137.115   
+
 
* Synonym(s):
 
* Synonym(s):
−
** salicylic acid
 
−
** o-hydroxybenzoic acid
 
−
** 2-hydroxybenzoic acid
 
−
** SA
 
−
** 2-HBA
 
−
** 2-hydroxybenzoate
 
−
** o-hydroxybenzoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''9''' reactions in the full pathway
−
* [[1.2.1.65-RXN]]
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
* [[RXNQT-4366]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-21_003730]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRROLINECARBREDUCT-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Ec-07_007350]]
 +
*** [[Ec-07_007360]]
 +
*** [[Ec-07_007340]]
 +
*** [[Ec-05_006410]]
 +
*** [[Ec-03_004680]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[SPONTPRO-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=24-DIAMINOPENTANOATE-DEHYDROGENASE-RXN 24-DIAMINOPENTANOATE-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=AKPTHIOL-RXN AKPTHIOL-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-RACEMASE-RXN ORNITHINE-RACEMASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ORNMUTST-RXN ORNMUTST-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PRDABST-RXN PRDABST-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 69-72-7
+
{{#set: taxonomic range=TAX-200918}}
−
* Wikipedia : Salicylate
+
{{#set: taxonomic range=TAX-201174}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675850 54675850]
+
{{#set: common name=L-ornithine degradation II (Stickland reaction)}}
−
* KNAPSACK : C00000206
+
{{#set: reaction found=3}}
−
* HMDB : HMDB01895
+
{{#set: total reaction=9}}
−
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00805 C00805]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4964.html 4964]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30762 30762]
+
−
{{#set: smiles=C(C1(=CC=CC=C1O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=YGSDEFSMJLZEOE-UHFFFAOYSA-M}}
+
−
{{#set: common name=salicylate}}
+
−
{{#set: molecular weight=137.115    }}
+
−
{{#set: common name=salicylic acid|o-hydroxybenzoic acid|2-hydroxybenzoic acid|SA|2-HBA|2-hydroxybenzoate|o-hydroxybenzoate}}
+
−
{{#set: produced by=1.2.1.65-RXN|RXNQT-4366}}
+

Revision as of 13:26, 21 March 2018

Pathway PWY-6344

Reaction(s) found

3 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MALATE-ASPARTATE-SHUTTLE-PWY&oldid=18538"