Difference between revisions of "Ec-20 003790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-130 RXN3O-130] == * direction: ** LEFT-TO-RIGHT * common name: ** Cytochrome P450 * ec number...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-130 RXN3O-130] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Cytochrome P450 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 3 [[OXYGEN-MOLECULE]][c] '''+''' 3 [[NADPH]][c] '''+''' 1 [[LANOSTEROL]][c] '''+''' 2 [[PROTON]][c] '''=>''' 4 [[WATER]][c] '''+''' 1 [[FORMATE]][c] '''+''' 3 [[NADP]][c] '''+''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 3 oxygen[c] '''+''' 3 NADPH[c] '''+''' 1 lanosterol[c] '''+''' 2 H+[c] '''=>''' 4 H2O[c] '''+''' 1 formate[c] '''+''' 3 NADP+[c] '''+''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-10_006240]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6074]], zymosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074] | ||
+ | ** '''4''' reactions found over '''12''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25287 25287] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05640 R05640] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=Cytochrome P450}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.14.13.70}} |
− | + | {{#set: gene associated=Ec-10_006240}} | |
− | + | {{#set: in pathway=PWY-6074}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:26, 21 March 2018
Contents
Reaction RXN3O-130
- direction:
- LEFT-TO-RIGHT
- common name:
- Cytochrome P450
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 3 OXYGEN-MOLECULE[c] + 3 NADPH[c] + 1 LANOSTEROL[c] + 2 PROTON[c] => 4 WATER[c] + 1 FORMATE[c] + 3 NADP[c] + 1 44-DIMETHYL-CHOLESTA-812-24-TRIENOL[c]
- With common name(s):
- 3 oxygen[c] + 3 NADPH[c] + 1 lanosterol[c] + 2 H+[c] => 4 H2O[c] + 1 formate[c] + 3 NADP+[c] + 1 4,4-dimethyl-cholesta-8,12,24-trienol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_006240
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links