Difference between revisions of "Ec-02 001850"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7380 PWY-7380] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7380 PWY-7380] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
−
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
+
 
* common name:
 
* common name:
−
** (2E)-5-methylhexa-2,4-dienoyl-CoA
+
** biotin biosynthesis from 8-amino-7-oxononanoate II
−
* molecular weight:
+
−
** 871.642   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** biotin biosynthesis from 7-keto-8-aminopelargonate II
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-11919]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.8.1.6-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-24_000980]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DETHIOBIOTIN-SYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_005750]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14930 RXN-14930]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176]
+
{{#set: common name=biotin biosynthesis from 8-amino-7-oxononanoate II}}
−
* LIGAND-CPD:
+
{{#set: common name=biotin biosynthesis from 7-keto-8-aminopelargonate II}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468]
+
{{#set: reaction found=2}}
−
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: total reaction=3}}
−
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}}
+
{{#set: completion rate=67.0}}
−
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}}
+
−
{{#set: molecular weight=871.642    }}
+
−
{{#set: consumed by=RXN-11919}}
+

Revision as of 13:26, 21 March 2018

Pathway PWY-7380

  • taxonomic range:
  • common name:
    • biotin biosynthesis from 8-amino-7-oxononanoate II
  • Synonym(s):
    • biotin biosynthesis from 7-keto-8-aminopelargonate II

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_001850&oldid=18548"