Difference between revisions of "PWY-5855"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6627 PWY-6627] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
+ | * inchi key: | ||
+ | ** InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** dGMP |
+ | * molecular weight: | ||
+ | ** 345.208 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** G | ||
+ | ** 2'-dG-5'-MP | ||
+ | ** 2'-deoxyguanosine 5'-monophosphate | ||
+ | ** guanine riboside | ||
+ | ** vernine | ||
+ | ** 2'-deoxyguanosine 5'-phosphate | ||
+ | ** deoxyguanosine-phosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14208]] | |
− | + | * [[RXN0-385]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14218]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 902-04-5 |
− | {{#set: common name= | + | * BIGG : 34744 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6994968 6994968] |
− | {{#set: | + | * HMDB : HMDB01044 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00362 C00362] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5362940.html 5362940] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57673 57673] | ||
+ | * METABOLIGHTS : MTBLC57673 | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L}} | ||
+ | {{#set: common name=dGMP}} | ||
+ | {{#set: molecular weight=345.208 }} | ||
+ | {{#set: common name=G|2'-dG-5'-MP|2'-deoxyguanosine 5'-monophosphate|guanine riboside|vernine|2'-deoxyguanosine 5'-phosphate|deoxyguanosine-phosphate}} | ||
+ | {{#set: produced by=RXN-14208|RXN0-385}} | ||
+ | {{#set: reversible reaction associated=RXN-14218}} |
Revision as of 13:26, 21 March 2018
Contents
Metabolite DGMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L
- common name:
- dGMP
- molecular weight:
- 345.208
- Synonym(s):
- G
- 2'-dG-5'-MP
- 2'-deoxyguanosine 5'-monophosphate
- guanine riboside
- vernine
- 2'-deoxyguanosine 5'-phosphate
- deoxyguanosine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 902-04-5
- BIGG : 34744
- PUBCHEM:
- HMDB : HMDB01044
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57673
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.